C28H46O12 — CID 154255767
bis[2-[2-(2-butoxyethoxy)ethoxy]ethyl] benzene-1,4-dicarboperoxoate (PubChem CID 154255767) has the molecular formula C28H46O12 and a molecular weight of 574.66 g/mol. Its IUPAC name is bis[2-[2-(2-butoxyethoxy)ethoxy]ethyl] benzene-1,4-dicarboperoxoate.
| Compound Name | bis[2-[2-(2-butoxyethoxy)ethoxy]ethyl] benzene-1,4-dicarboperoxoate |
|---|---|
| PubChem CID | 154255767 |
| Molecular Formula | C28H46O12 |
| Molecular Weight | 574.66 g/mol |
| Exact Mass | 574.30 |
| IUPAC Name | bis[2-[2-(2-butoxyethoxy)ethoxy]ethyl] benzene-1,4-dicarboperoxoate |
| SMILES | CCCCOCCOCCOCCOOC(=O)c1ccc(C(=O)OOCCOCCOCCOCCCC)cc1 |
| InChI | InChI=1S/C28H46O12/c1-3-5-11-31-13-15-33-17-19-35-21-23-37-39-27(29)25-7-9-26(10-8-25)28(30)40-38-24-22-36-20-18-34-16-14-32-12-6-4-2/h7-10H,3-6,11-24H2,1-2H3 |
| InChIKey | PNAQZRUTQPFXIZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.66 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|