2-butoxyethyl 3-methoxybenzenecarboperoxoate

C14H20O5 — CID 173266917

IUPAC2-butoxyethyl 3-methoxybenzenecarboperoxoate
SMILESCCCCOCCOOC(=O)c1cccc(OC)c1
InChIInChI=1S/C14H20O5/c1-3-4-8-17-9-10-18-19-14(15)12-6-5-7-13(11-12)16-2/h5-7,11H,3-4,8-10H2,1-2H3
InChIKeyXRRKZQROKMZCMS-UHFFFAOYSA-N
MW268.31 g/mol
LogP2.60
Rot. Bonds9

About 2-butoxyethyl 3-methoxybenzenecarboperoxoate

2-butoxyethyl 3-methoxybenzenecarboperoxoate (PubChem CID 173266917) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-butoxyethyl 3-methoxybenzenecarboperoxoate.

Molecular Properties

Compound Name2-butoxyethyl 3-methoxybenzenecarboperoxoate
PubChem CID173266917
Molecular FormulaC14H20O5
Molecular Weight268.31 g/mol
Exact Mass268.13
IUPAC Name2-butoxyethyl 3-methoxybenzenecarboperoxoate
SMILESCCCCOCCOOC(=O)c1cccc(OC)c1
InChIInChI=1S/C14H20O5/c1-3-4-8-17-9-10-18-19-14(15)12-6-5-7-13(11-12)16-2/h5-7,11H,3-4,8-10H2,1-2H3
InChIKeyXRRKZQROKMZCMS-UHFFFAOYSA-N
XLogP2.60
TPSA53.99 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.31
LogP ≤ 52.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze 2-butoxyethyl 3-methoxybenzenecarboperoxoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-butoxyethyl 3-methoxybenzenecarboperoxoate?
The IUPAC name of 2-butoxyethyl 3-methoxybenzenecarboperoxoate (CID 173266917) is 2-butoxyethyl 3-methoxybenzenecarboperoxoate.
What is the SMILES notation for 2-butoxyethyl 3-methoxybenzenecarboperoxoate?
The canonical SMILES for 2-butoxyethyl 3-methoxybenzenecarboperoxoate is CCCCOCCOOC(=O)c1cccc(OC)c1.
What is the InChIKey of 2-butoxyethyl 3-methoxybenzenecarboperoxoate?
The InChIKey is XRRKZQROKMZCMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O5/c1-3-4-8-17-9-10-18-19-14(15)12-6-5-7-13(11-12)16-2/h5-7,11H,3-4,8-10H2,1-2H3.
What are the key properties of 2-butoxyethyl 3-methoxybenzenecarboperoxoate?
2-butoxyethyl 3-methoxybenzenecarboperoxoate has a molecular weight of 268.31 g/mol, XLogP of 2.60, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxyethyl 3-methoxybenzenecarboperoxoate is sourced from PubChem (CID 173266917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).