About hex-1-en-2-yl 3-methoxybenzoate
hex-1-en-2-yl 3-methoxybenzoate (PubChem CID 73010414) has the molecular formula C14H18O3
and a molecular weight of 234.29 g/mol. Its IUPAC name is hex-1-en-2-yl 3-methoxybenzoate.
Molecular Properties
| Compound Name | hex-1-en-2-yl 3-methoxybenzoate |
| PubChem CID | 73010414 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | hex-1-en-2-yl 3-methoxybenzoate |
| SMILES | C=C(CCCC)OC(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C14H18O3/c1-4-5-7-11(2)17-14(15)12-8-6-9-13(10-12)16-3/h6,8-10H,2,4-5,7H2,1,3H3 |
| InChIKey | OZXLZBIZMHOCAU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze hex-1-en-2-yl 3-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-1-en-2-yl 3-methoxybenzoate?
The IUPAC name of hex-1-en-2-yl 3-methoxybenzoate (CID 73010414) is hex-1-en-2-yl 3-methoxybenzoate.
What is the SMILES notation for hex-1-en-2-yl 3-methoxybenzoate?
The canonical SMILES for hex-1-en-2-yl 3-methoxybenzoate is C=C(CCCC)OC(=O)c1cccc(OC)c1.
What is the InChIKey of hex-1-en-2-yl 3-methoxybenzoate?
The InChIKey is OZXLZBIZMHOCAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3/c1-4-5-7-11(2)17-14(15)12-8-6-9-13(10-12)16-3/h6,8-10H,2,4-5,7H2,1,3H3.
What are the key properties of hex-1-en-2-yl 3-methoxybenzoate?
hex-1-en-2-yl 3-methoxybenzoate has a molecular weight of 234.29 g/mol, XLogP of 3.56, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hex-1-en-2-yl 3-methoxybenzoate is sourced from PubChem (CID 73010414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).