C20H22O2 — CID 122403772
1-methoxy-3-[5-(3-methoxyphenyl)hexa-1,5-dien-2-yl]benzene (PubChem CID 122403772) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 1-methoxy-3-[5-(3-methoxyphenyl)hexa-1,5-dien-2-yl]benzene.
| Compound Name | 1-methoxy-3-[5-(3-methoxyphenyl)hexa-1,5-dien-2-yl]benzene |
|---|---|
| PubChem CID | 122403772 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 1-methoxy-3-[5-(3-methoxyphenyl)hexa-1,5-dien-2-yl]benzene |
| SMILES | C=C(CCC(=C)c1cccc(OC)c1)c1cccc(OC)c1 |
| InChI | InChI=1S/C20H22O2/c1-15(17-7-5-9-19(13-17)21-3)11-12-16(2)18-8-6-10-20(14-18)22-4/h5-10,13-14H,1-2,11-12H2,3-4H3 |
| InChIKey | DVRXLMXLZDAGTJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |