C13H14Cl3NO2 — CID 135073633
3-(3-methoxyphenyl)but-3-enyl 2,2,2-trichloroethanimidate (PubChem CID 135073633) has the molecular formula C13H14Cl3NO2 and a molecular weight of 322.62 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)but-3-enyl 2,2,2-trichloroethanimidate.
| Compound Name | 3-(3-methoxyphenyl)but-3-enyl 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 135073633 |
| Molecular Formula | C13H14Cl3NO2 |
| Molecular Weight | 322.62 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 3-(3-methoxyphenyl)but-3-enyl 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OCCC(=C)c1cccc(OC)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H14Cl3NO2/c1-9(6-7-19-12(17)13(14,15)16)10-4-3-5-11(8-10)18-2/h3-5,8,17H,1,6-7H2,2H3/b17-12+ |
| InChIKey | YLSVNZUFUOPSSX-SFQUDFHCSA-N |
| XLogP | 4.46 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.62 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|