C10H14N2O — CID 63182019
3-methoxy-N,N-dimethylbenzenecarboximidamide (PubChem CID 63182019) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 3-methoxy-N,N-dimethylbenzenecarboximidamide.
| Compound Name | 3-methoxy-N,N-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 63182019 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 3-methoxy-N,N-dimethylbenzenecarboximidamide |
| SMILES | [H]/N=C(/c1cccc(OC)c1)N(C)C |
| InChI | InChI=1S/C10H14N2O/c1-12(2)10(11)8-5-4-6-9(7-8)13-3/h4-7,11H,1-3H3/b11-10- |
| InChIKey | GEOBWKOHSGCXGA-KHPPLWFESA-N |
| XLogP | 1.58 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|