C11H16N2O2 — CID 63181250
3,4-dimethoxy-N,N-dimethylbenzenecarboximidamide (PubChem CID 63181250) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 3,4-dimethoxy-N,N-dimethylbenzenecarboximidamide.
| Compound Name | 3,4-dimethoxy-N,N-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 63181250 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 3,4-dimethoxy-N,N-dimethylbenzenecarboximidamide |
| SMILES | [H]/N=C(/c1ccc(OC)c(OC)c1)N(C)C |
| InChI | InChI=1S/C11H16N2O2/c1-13(2)11(12)8-5-6-9(14-3)10(7-8)15-4/h5-7,12H,1-4H3/b12-11- |
| InChIKey | BJISHBWTYLRMBE-QXMHVHEDSA-N |
| XLogP | 1.59 |
| TPSA | 45.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|