C14H20N2O2 — CID 63179479
(3,4-dimethoxyphenyl)-piperidin-1-ylmethanimine (PubChem CID 63179479) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-piperidin-1-ylmethanimine.
| Compound Name | (3,4-dimethoxyphenyl)-piperidin-1-ylmethanimine |
|---|---|
| PubChem CID | 63179479 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | (3,4-dimethoxyphenyl)-piperidin-1-ylmethanimine |
| SMILES | [H]/N=C(/c1ccc(OC)c(OC)c1)N1CCCCC1 |
| InChI | InChI=1S/C14H20N2O2/c1-17-12-7-6-11(10-13(12)18-2)14(15)16-8-4-3-5-9-16/h6-7,10,15H,3-5,8-9H2,1-2H3/b15-14- |
| InChIKey | JMAIJOAKHDBHQY-PFONDFGASA-N |
| XLogP | 2.52 |
| TPSA | 45.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|