C16H24N2O5 — CID 144580065
(3,4-dimethoxyphenyl)-pyrrolidin-1-ylmethanone;N-methoxy-N-methylformamide (PubChem CID 144580065) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-pyrrolidin-1-ylmethanone;N-methoxy-N-methylformamide.
| Compound Name | (3,4-dimethoxyphenyl)-pyrrolidin-1-ylmethanone;N-methoxy-N-methylformamide |
|---|---|
| PubChem CID | 144580065 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | (3,4-dimethoxyphenyl)-pyrrolidin-1-ylmethanone;N-methoxy-N-methylformamide |
| SMILES | CON(C)C=O.COc1ccc(C(=O)N2CCCC2)cc1OC |
| InChI | InChI=1S/C13H17NO3.C3H7NO2/c1-16-11-6-5-10(9-12(11)17-2)13(15)14-7-3-4-8-14;1-4(3-5)6-2/h5-6,9H,3-4,7-8H2,1-2H3;3H,1-2H3 |
| InChIKey | PEUMUCBWIRFSIS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|