C18H28N2O3 — CID 47085264
(4-tert-butyl-1,4-diazepan-1-yl)-(3,4-dimethoxyphenyl)methanone (PubChem CID 47085264) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is (4-tert-butyl-1,4-diazepan-1-yl)-(3,4-dimethoxyphenyl)methanone.
| Compound Name | (4-tert-butyl-1,4-diazepan-1-yl)-(3,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 47085264 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | (4-tert-butyl-1,4-diazepan-1-yl)-(3,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCCN(C(C)(C)C)CC2)cc1OC |
| InChI | InChI=1S/C18H28N2O3/c1-18(2,3)20-10-6-9-19(11-12-20)17(21)14-7-8-15(22-4)16(13-14)23-5/h7-8,13H,6,9-12H2,1-5H3 |
| InChIKey | XOFBKLLGNDYBJW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |