C25H34N2O4 — CID 108543820
[4-(adamantane-1-carbonyl)-1,4-diazepan-1-yl]-(3,4-dimethoxyphenyl)methanone (PubChem CID 108543820) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is [4-(adamantane-1-carbonyl)-1,4-diazepan-1-yl]-(3,4-dimethoxyphenyl)methanone.
| Compound Name | [4-(adamantane-1-carbonyl)-1,4-diazepan-1-yl]-(3,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 108543820 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | [4-(adamantane-1-carbonyl)-1,4-diazepan-1-yl]-(3,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCCN(C(=O)C34CC5CC(CC(C5)C3)C4)CC2)cc1OC |
| InChI | InChI=1S/C25H34N2O4/c1-30-21-5-4-20(13-22(21)31-2)23(28)26-6-3-7-27(9-8-26)24(29)25-14-17-10-18(15-25)12-19(11-17)16-25/h4-5,13,17-19H,3,6-12,14-16H2,1-2H3 |
| InChIKey | HSCSHXVOKQQIHD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |