C22H30N2O4 — CID 108935081
(E)-3-cyclopentyl-1-[4-(3,4-dimethoxybenzoyl)-1,4-diazepan-1-yl]prop-2-en-1-one (PubChem CID 108935081) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is (E)-3-cyclopentyl-1-[4-(3,4-dimethoxybenzoyl)-1,4-diazepan-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-cyclopentyl-1-[4-(3,4-dimethoxybenzoyl)-1,4-diazepan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 108935081 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | (E)-3-cyclopentyl-1-[4-(3,4-dimethoxybenzoyl)-1,4-diazepan-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)N2CCCN(C(=O)/C=C/C3CCCC3)CC2)cc1OC |
| InChI | InChI=1S/C22H30N2O4/c1-27-19-10-9-18(16-20(19)28-2)22(26)24-13-5-12-23(14-15-24)21(25)11-8-17-6-3-4-7-17/h8-11,16-17H,3-7,12-15H2,1-2H3/b11-8+ |
| InChIKey | IFSVOIHUUGKPLM-DHZHZOJOSA-N |
| XLogP | 3.12 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|