C20H22N2O6 — CID 108533494
[4-(3,5-dihydroxybenzoyl)piperazin-1-yl]-(3,4-dimethoxyphenyl)methanone (PubChem CID 108533494) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is [4-(3,5-dihydroxybenzoyl)piperazin-1-yl]-(3,4-dimethoxyphenyl)methanone.
| Compound Name | [4-(3,5-dihydroxybenzoyl)piperazin-1-yl]-(3,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 108533494 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | [4-(3,5-dihydroxybenzoyl)piperazin-1-yl]-(3,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCN(C(=O)c3cc(O)cc(O)c3)CC2)cc1OC |
| InChI | InChI=1S/C20H22N2O6/c1-27-17-4-3-13(11-18(17)28-2)19(25)21-5-7-22(8-6-21)20(26)14-9-15(23)12-16(24)10-14/h3-4,9-12,23-24H,5-8H2,1-2H3 |
| InChIKey | FCZHTXCJBYZABC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |