C17H22N4O3 — CID 68867028
3-[2-ethoxy-4-(pyrrolidine-1-carboximidoyl)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 68867028) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 3-[2-ethoxy-4-(pyrrolidine-1-carboximidoyl)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | 3-[2-ethoxy-4-(pyrrolidine-1-carboximidoyl)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 68867028 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 3-[2-ethoxy-4-(pyrrolidine-1-carboximidoyl)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | [H]/N=C(/c1ccc(C2=NOC(C(N)=O)C2)c(OCC)c1)N1CCCC1 |
| InChI | InChI=1S/C17H22N4O3/c1-2-23-14-9-11(16(18)21-7-3-4-8-21)5-6-12(14)13-10-15(17(19)22)24-20-13/h5-6,9,15,18H,2-4,7-8,10H2,1H3,(H2,19,22)/b18-16- |
| InChIKey | CFXCMSSTBXTVHR-VLGSPTGOSA-N |
| XLogP | 1.48 |
| TPSA | 101.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|