C16H18N4O2S — CID 68863147
3-[2-methylsulfanyl-4-(pyrrolidine-1-carboximidoyl)phenyl]-1,2-oxazole-5-carboxamide (PubChem CID 68863147) has the molecular formula C16H18N4O2S and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-[2-methylsulfanyl-4-(pyrrolidine-1-carboximidoyl)phenyl]-1,2-oxazole-5-carboxamide.
| Compound Name | 3-[2-methylsulfanyl-4-(pyrrolidine-1-carboximidoyl)phenyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 68863147 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 3-[2-methylsulfanyl-4-(pyrrolidine-1-carboximidoyl)phenyl]-1,2-oxazole-5-carboxamide |
| SMILES | [H]/N=C(/c1ccc(-c2cc(C(N)=O)on2)c(SC)c1)N1CCCC1 |
| InChI | InChI=1S/C16H18N4O2S/c1-23-14-8-10(15(17)20-6-2-3-7-20)4-5-11(14)12-9-13(16(18)21)22-19-12/h4-5,8-9,17H,2-3,6-7H2,1H3,(H2,18,21)/b17-15- |
| InChIKey | WMLDXDUWFJQKPH-ICFOKQHNSA-N |
| XLogP | 2.58 |
| TPSA | 96.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|