C19H17ClN4O2S — CID 11668481
N-[[3-[4-(azetidine-1-carboximidoyl)phenyl]-1,2-oxazol-5-yl]methyl]-5-chlorothiophene-2-carboxamide (PubChem CID 11668481) has the molecular formula C19H17ClN4O2S and a molecular weight of 400.89 g/mol. Its IUPAC name is N-[[3-[4-(azetidine-1-carboximidoyl)phenyl]-1,2-oxazol-5-yl]methyl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[[3-[4-(azetidine-1-carboximidoyl)phenyl]-1,2-oxazol-5-yl]methyl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 11668481 |
| Molecular Formula | C19H17ClN4O2S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | N-[[3-[4-(azetidine-1-carboximidoyl)phenyl]-1,2-oxazol-5-yl]methyl]-5-chlorothiophene-2-carboxamide |
| SMILES | [H]/N=C(/c1ccc(-c2cc(CNC(=O)c3ccc(Cl)s3)on2)cc1)N1CCC1 |
| InChI | InChI=1S/C19H17ClN4O2S/c20-17-7-6-16(27-17)19(25)22-11-14-10-15(23-26-14)12-2-4-13(5-3-12)18(21)24-8-1-9-24/h2-7,10,21H,1,8-9,11H2,(H,22,25)/b21-18- |
| InChIKey | IJWNRCYOXDDNSE-UZYVYHOESA-N |
| XLogP | 4.02 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|