C19H19ClFN3O2S2 — CID 71505720
S-[2-[(5-chlorothiophene-2-carbonyl)amino]ethyl] 2-fluoro-4-(pyrrolidine-1-carboximidoyl)benzenecarbothioate (PubChem CID 71505720) has the molecular formula C19H19ClFN3O2S2 and a molecular weight of 439.97 g/mol. Its IUPAC name is S-[2-[(5-chlorothiophene-2-carbonyl)amino]ethyl] 2-fluoro-4-(pyrrolidine-1-carboximidoyl)benzenecarbothioate.
| Compound Name | S-[2-[(5-chlorothiophene-2-carbonyl)amino]ethyl] 2-fluoro-4-(pyrrolidine-1-carboximidoyl)benzenecarbothioate |
|---|---|
| PubChem CID | 71505720 |
| Molecular Formula | C19H19ClFN3O2S2 |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | S-[2-[(5-chlorothiophene-2-carbonyl)amino]ethyl] 2-fluoro-4-(pyrrolidine-1-carboximidoyl)benzenecarbothioate |
| SMILES | [H]/N=C(/c1ccc(C(=O)SCCNC(=O)c2ccc(Cl)s2)c(F)c1)N1CCCC1 |
| InChI | InChI=1S/C19H19ClFN3O2S2/c20-16-6-5-15(28-16)18(25)23-7-10-27-19(26)13-4-3-12(11-14(13)21)17(22)24-8-1-2-9-24/h3-6,11,22H,1-2,7-10H2,(H,23,25)/b22-17- |
| InChIKey | LTSYWXVXLPCEHQ-XLNRJJMWSA-N |
| XLogP | 4.27 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|