C22H24ClN5O2S — CID 91389203
N-[(7R,7aR)-3-oxo-2-[4-(pyrrolidine-1-carboximidoyl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-7-yl]-5-chlorothiophene-2-carboxamide (PubChem CID 91389203) has the molecular formula C22H24ClN5O2S and a molecular weight of 457.99 g/mol. Its IUPAC name is N-[(7R,7aR)-3-oxo-2-[4-(pyrrolidine-1-carboximidoyl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-7-yl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[(7R,7aR)-3-oxo-2-[4-(pyrrolidine-1-carboximidoyl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-7-yl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 91389203 |
| Molecular Formula | C22H24ClN5O2S |
| Molecular Weight | 457.99 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | N-[(7R,7aR)-3-oxo-2-[4-(pyrrolidine-1-carboximidoyl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-7-yl]-5-chlorothiophene-2-carboxamide |
| SMILES | [H]/N=C(/c1ccc(N2C[C@@H]3[C@H](NC(=O)c4ccc(Cl)s4)CCN3C2=O)cc1)N1CCCC1 |
| InChI | InChI=1S/C22H24ClN5O2S/c23-19-8-7-18(31-19)21(29)25-16-9-12-27-17(16)13-28(22(27)30)15-5-3-14(4-6-15)20(24)26-10-1-2-11-26/h3-8,16-17,24H,1-2,9-13H2,(H,25,29)/b24-20-/t16-,17-/m1/s1 |
| InChIKey | YTWGSGHXCHQSBS-BJMDOTLUSA-N |
| XLogP | 3.64 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.99 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|