C23H23ClN4O3S — CID 91071994
N-[(7R,7aR)-3-oxo-2-[4-(3-oxo-2-azabicyclo[2.2.1]heptan-2-yl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-7-yl]-5-chlorothiophene-2-carboxamide (PubChem CID 91071994) has the molecular formula C23H23ClN4O3S and a molecular weight of 470.98 g/mol. Its IUPAC name is N-[(7R,7aR)-3-oxo-2-[4-(3-oxo-2-azabicyclo[2.2.1]heptan-2-yl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-7-yl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[(7R,7aR)-3-oxo-2-[4-(3-oxo-2-azabicyclo[2.2.1]heptan-2-yl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-7-yl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 91071994 |
| Molecular Formula | C23H23ClN4O3S |
| Molecular Weight | 470.98 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | N-[(7R,7aR)-3-oxo-2-[4-(3-oxo-2-azabicyclo[2.2.1]heptan-2-yl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-7-yl]-5-chlorothiophene-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCN2C(=O)N(c3ccc(N4C(=O)C5CCC4C5)cc3)C[C@H]12)c1ccc(Cl)s1 |
| InChI | InChI=1S/C23H23ClN4O3S/c24-20-8-7-19(32-20)21(29)25-17-9-10-26-18(17)12-27(23(26)31)14-3-5-15(6-4-14)28-16-2-1-13(11-16)22(28)30/h3-8,13,16-18H,1-2,9-12H2,(H,25,29)/t13?,16?,17-,18-/m1/s1 |
| InChIKey | SWEBGPAAIVOOBK-BLYBZDDLSA-N |
| XLogP | 3.73 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.98 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |