C22H25ClN4O2S — CID 91253352
N-[(7R,7aS)-2-[4-[1-(dimethylamino)cyclopropyl]phenyl]-1-oxo-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-7-yl]-5-chlorothiophene-2-carboxamide (PubChem CID 91253352) has the molecular formula C22H25ClN4O2S and a molecular weight of 444.99 g/mol. Its IUPAC name is N-[(7R,7aS)-2-[4-[1-(dimethylamino)cyclopropyl]phenyl]-1-oxo-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-7-yl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[(7R,7aS)-2-[4-[1-(dimethylamino)cyclopropyl]phenyl]-1-oxo-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-7-yl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 91253352 |
| Molecular Formula | C22H25ClN4O2S |
| Molecular Weight | 444.99 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-[(7R,7aS)-2-[4-[1-(dimethylamino)cyclopropyl]phenyl]-1-oxo-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-7-yl]-5-chlorothiophene-2-carboxamide |
| SMILES | CN(C)C1(c2ccc(N3CN4CC[C@@H](NC(=O)c5ccc(Cl)s5)[C@H]4C3=O)cc2)CC1 |
| InChI | InChI=1S/C22H25ClN4O2S/c1-25(2)22(10-11-22)14-3-5-15(6-4-14)27-13-26-12-9-16(19(26)21(27)29)24-20(28)17-7-8-18(23)30-17/h3-8,16,19H,9-13H2,1-2H3,(H,24,28)/t16-,19+/m1/s1 |
| InChIKey | TVKGTYRYASNNQQ-APWZRJJASA-N |
| XLogP | 3.13 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.99 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |