C26H33ClN4O3S — CID 90796074
N-[(7R,7aR)-2-[4-(2-methyl-4-morpholin-4-ylbutan-2-yl)phenyl]-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-7-yl]-5-chlorothiophene-2-carboxamide (PubChem CID 90796074) has the molecular formula C26H33ClN4O3S and a molecular weight of 517.10 g/mol. Its IUPAC name is N-[(7R,7aR)-2-[4-(2-methyl-4-morpholin-4-ylbutan-2-yl)phenyl]-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-7-yl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[(7R,7aR)-2-[4-(2-methyl-4-morpholin-4-ylbutan-2-yl)phenyl]-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-7-yl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 90796074 |
| Molecular Formula | C26H33ClN4O3S |
| Molecular Weight | 517.10 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | N-[(7R,7aR)-2-[4-(2-methyl-4-morpholin-4-ylbutan-2-yl)phenyl]-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-7-yl]-5-chlorothiophene-2-carboxamide |
| SMILES | CC(C)(CCN1CCOCC1)c1ccc(N2C[C@@H]3[C@H](NC(=O)c4ccc(Cl)s4)CCN3C2=O)cc1 |
| InChI | InChI=1S/C26H33ClN4O3S/c1-26(2,10-12-29-13-15-34-16-14-29)18-3-5-19(6-4-18)31-17-21-20(9-11-30(21)25(31)33)28-24(32)22-7-8-23(27)35-22/h3-8,20-21H,9-17H2,1-2H3,(H,28,32)/t20-,21-/m1/s1 |
| InChIKey | UPAQJNZPITUQGH-NHCUHLMSSA-N |
| XLogP | 4.21 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.10 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |