C22H25ClN4O2S — CID 91566981
5-chloro-N-[[5-methyl-3-[4-(piperidine-1-carboximidoyl)phenyl]-2H-1,2-oxazol-5-yl]methyl]thiophene-2-carboxamide (PubChem CID 91566981) has the molecular formula C22H25ClN4O2S and a molecular weight of 444.99 g/mol. Its IUPAC name is 5-chloro-N-[[5-methyl-3-[4-(piperidine-1-carboximidoyl)phenyl]-2H-1,2-oxazol-5-yl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[[5-methyl-3-[4-(piperidine-1-carboximidoyl)phenyl]-2H-1,2-oxazol-5-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 91566981 |
| Molecular Formula | C22H25ClN4O2S |
| Molecular Weight | 444.99 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 5-chloro-N-[[5-methyl-3-[4-(piperidine-1-carboximidoyl)phenyl]-2H-1,2-oxazol-5-yl]methyl]thiophene-2-carboxamide |
| SMILES | [H]/N=C(/c1ccc(C2=CC(C)(CNC(=O)c3ccc(Cl)s3)ON2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C22H25ClN4O2S/c1-22(14-25-21(28)18-9-10-19(23)30-18)13-17(26-29-22)15-5-7-16(8-6-15)20(24)27-11-3-2-4-12-27/h5-10,13,24,26H,2-4,11-12,14H2,1H3,(H,25,28)/b24-20- |
| InChIKey | ARCNCFPMTPIETC-GFMRDNFCSA-N |
| XLogP | 4.28 |
| TPSA | 77.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.99 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|