C21H20ClN3O2S — CID 162193838
1-(5-chlorothiophen-2-yl)-3-[2-[4-(pyrrolidine-1-carboximidoyl)phenyl]-1,3-oxazol-4-yl]propan-1-one (PubChem CID 162193838) has the molecular formula C21H20ClN3O2S and a molecular weight of 413.93 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-3-[2-[4-(pyrrolidine-1-carboximidoyl)phenyl]-1,3-oxazol-4-yl]propan-1-one.
| Compound Name | 1-(5-chlorothiophen-2-yl)-3-[2-[4-(pyrrolidine-1-carboximidoyl)phenyl]-1,3-oxazol-4-yl]propan-1-one |
|---|---|
| PubChem CID | 162193838 |
| Molecular Formula | C21H20ClN3O2S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-3-[2-[4-(pyrrolidine-1-carboximidoyl)phenyl]-1,3-oxazol-4-yl]propan-1-one |
| SMILES | [H]/N=C(/c1ccc(-c2nc(CCC(=O)c3ccc(Cl)s3)co2)cc1)N1CCCC1 |
| InChI | InChI=1S/C21H20ClN3O2S/c22-19-10-9-18(28-19)17(26)8-7-16-13-27-21(24-16)15-5-3-14(4-6-15)20(23)25-11-1-2-12-25/h3-6,9-10,13,23H,1-2,7-8,11-12H2/b23-20- |
| InChIKey | ZQRGQBOVNZANDE-ATJXCDBQSA-N |
| XLogP | 5.29 |
| TPSA | 70.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|