C25H26ClN3O4S — CID 159823414
ethyl 1-[4-[4-[3-(5-chlorothiophen-2-yl)-3-oxopropyl]-1,3-oxazol-2-yl]benzenecarboximidoyl]piperidine-4-carboxylate (PubChem CID 159823414) has the molecular formula C25H26ClN3O4S and a molecular weight of 500.02 g/mol. Its IUPAC name is ethyl 1-[4-[4-[3-(5-chlorothiophen-2-yl)-3-oxopropyl]-1,3-oxazol-2-yl]benzenecarboximidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[4-[3-(5-chlorothiophen-2-yl)-3-oxopropyl]-1,3-oxazol-2-yl]benzenecarboximidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 159823414 |
| Molecular Formula | C25H26ClN3O4S |
| Molecular Weight | 500.02 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | ethyl 1-[4-[4-[3-(5-chlorothiophen-2-yl)-3-oxopropyl]-1,3-oxazol-2-yl]benzenecarboximidoyl]piperidine-4-carboxylate |
| SMILES | [H]/N=C(/c1ccc(-c2nc(CCC(=O)c3ccc(Cl)s3)co2)cc1)N1CCC(C(=O)OCC)CC1 |
| InChI | InChI=1S/C25H26ClN3O4S/c1-2-32-25(31)18-11-13-29(14-12-18)23(27)16-3-5-17(6-4-16)24-28-19(15-33-24)7-8-20(30)21-9-10-22(26)34-21/h3-6,9-10,15,18,27H,2,7-8,11-14H2,1H3/b27-23- |
| InChIKey | NMNIWJFLWQHLMS-VYIQYICTSA-N |
| XLogP | 5.47 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.02 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|