C16H21N3O3 — CID 142175109
ethyl 1-(4-carbamoylbenzenecarboximidoyl)piperidine-4-carboxylate (PubChem CID 142175109) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is ethyl 1-(4-carbamoylbenzenecarboximidoyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(4-carbamoylbenzenecarboximidoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 142175109 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | ethyl 1-(4-carbamoylbenzenecarboximidoyl)piperidine-4-carboxylate |
| SMILES | [H]/N=C(/c1ccc(C(N)=O)cc1)N1CCC(C(=O)OCC)CC1 |
| InChI | InChI=1S/C16H21N3O3/c1-2-22-16(21)13-7-9-19(10-8-13)14(17)11-3-5-12(6-4-11)15(18)20/h3-6,13,17H,2,7-10H2,1H3,(H2,18,20)/b17-14- |
| InChIKey | VERXJKBLFVWWMC-VKAVYKQESA-N |
| XLogP | 1.39 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|