C24H28ClN5O3S — CID 11713077
5-chloro-N-[[3-[2-morpholin-4-yl-4-(pyrrolidine-1-carboximidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]thiophene-2-carboxamide (PubChem CID 11713077) has the molecular formula C24H28ClN5O3S and a molecular weight of 502.04 g/mol. Its IUPAC name is 5-chloro-N-[[3-[2-morpholin-4-yl-4-(pyrrolidine-1-carboximidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[[3-[2-morpholin-4-yl-4-(pyrrolidine-1-carboximidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 11713077 |
| Molecular Formula | C24H28ClN5O3S |
| Molecular Weight | 502.04 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | 5-chloro-N-[[3-[2-morpholin-4-yl-4-(pyrrolidine-1-carboximidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]thiophene-2-carboxamide |
| SMILES | [H]/N=C(/c1ccc(C2=NOC(CNC(=O)c3ccc(Cl)s3)C2)c(N2CCOCC2)c1)N1CCCC1 |
| InChI | InChI=1S/C24H28ClN5O3S/c25-22-6-5-21(34-22)24(31)27-15-17-14-19(28-33-17)18-4-3-16(23(26)30-7-1-2-8-30)13-20(18)29-9-11-32-12-10-29/h3-6,13,17,26H,1-2,7-12,14-15H2,(H,27,31)/b26-23- |
| InChIKey | XTCOKDFOEAOJNX-RWEWTDSWSA-N |
| XLogP | 3.58 |
| TPSA | 90.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.04 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|