C19H20ClN3O3S — CID 10158209
5-chloro-N-[[(5S)-2-oxo-3-(4-pyrrolidin-1-ylphenyl)-1,3-oxazolidin-5-yl]methyl]thiophene-2-carboxamide (PubChem CID 10158209) has the molecular formula C19H20ClN3O3S and a molecular weight of 405.91 g/mol. Its IUPAC name is 5-chloro-N-[[(5S)-2-oxo-3-(4-pyrrolidin-1-ylphenyl)-1,3-oxazolidin-5-yl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[[(5S)-2-oxo-3-(4-pyrrolidin-1-ylphenyl)-1,3-oxazolidin-5-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 10158209 |
| Molecular Formula | C19H20ClN3O3S |
| Molecular Weight | 405.91 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 5-chloro-N-[[(5S)-2-oxo-3-(4-pyrrolidin-1-ylphenyl)-1,3-oxazolidin-5-yl]methyl]thiophene-2-carboxamide |
| SMILES | O=C(NC[C@H]1CN(c2ccc(N3CCCC3)cc2)C(=O)O1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C19H20ClN3O3S/c20-17-8-7-16(27-17)18(24)21-11-15-12-23(19(25)26-15)14-5-3-13(4-6-14)22-9-1-2-10-22/h3-8,15H,1-2,9-12H2,(H,21,24)/t15-/m0/s1 |
| InChIKey | IQOWGQZZKKHHOD-HNNXBMFYSA-N |
| XLogP | 3.76 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.91 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|