C16H16ClN3O4S — CID 142207900
5-chloro-N-[[3-[4-(methoxyamino)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]thiophene-2-carboxamide (PubChem CID 142207900) has the molecular formula C16H16ClN3O4S and a molecular weight of 381.84 g/mol. Its IUPAC name is 5-chloro-N-[[3-[4-(methoxyamino)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[[3-[4-(methoxyamino)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 142207900 |
| Molecular Formula | C16H16ClN3O4S |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 5-chloro-N-[[3-[4-(methoxyamino)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]thiophene-2-carboxamide |
| SMILES | CONc1ccc(N2CC(CNC(=O)c3ccc(Cl)s3)OC2=O)cc1 |
| InChI | InChI=1S/C16H16ClN3O4S/c1-23-19-10-2-4-11(5-3-10)20-9-12(24-16(20)22)8-18-15(21)13-6-7-14(17)25-13/h2-7,12,19H,8-9H2,1H3,(H,18,21) |
| InChIKey | KTPKLHJLCLZWHB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|