C19H22ClN5O3S — CID 91302859
5-chloro-N-[[3-[4-[2-(methyliminomethylamino)ethylamino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]thiophene-2-carboxamide (PubChem CID 91302859) has the molecular formula C19H22ClN5O3S and a molecular weight of 435.94 g/mol. Its IUPAC name is 5-chloro-N-[[3-[4-[2-(methyliminomethylamino)ethylamino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[[3-[4-[2-(methyliminomethylamino)ethylamino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 91302859 |
| Molecular Formula | C19H22ClN5O3S |
| Molecular Weight | 435.94 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 5-chloro-N-[[3-[4-[2-(methyliminomethylamino)ethylamino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]thiophene-2-carboxamide |
| SMILES | C/N=C/NCCNc1ccc(N2CC(CNC(=O)c3ccc(Cl)s3)OC2=O)cc1 |
| InChI | InChI=1S/C19H22ClN5O3S/c1-21-12-22-8-9-23-13-2-4-14(5-3-13)25-11-15(28-19(25)27)10-24-18(26)16-6-7-17(20)29-16/h2-7,12,15,23H,8-11H2,1H3,(H,21,22)(H,24,26) |
| InChIKey | PUXWMVUZIAHUIR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.94 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|