C20H24ClN5O3S — CID 70249921
N-[[(5S)-3-[4-[2-(1-aminopropylideneamino)ethylamino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-5-chlorothiophene-2-carboxamide (PubChem CID 70249921) has the molecular formula C20H24ClN5O3S and a molecular weight of 449.96 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[2-(1-aminopropylideneamino)ethylamino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[[(5S)-3-[4-[2-(1-aminopropylideneamino)ethylamino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 70249921 |
| Molecular Formula | C20H24ClN5O3S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | N-[[(5S)-3-[4-[2-(1-aminopropylideneamino)ethylamino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-5-chlorothiophene-2-carboxamide |
| SMILES | CC/C(N)=N\CCNc1ccc(N2C[C@H](CNC(=O)c3ccc(Cl)s3)OC2=O)cc1 |
| InChI | InChI=1S/C20H24ClN5O3S/c1-2-18(22)24-10-9-23-13-3-5-14(6-4-13)26-12-15(29-20(26)28)11-25-19(27)16-7-8-17(21)30-16/h3-8,15,23H,2,9-12H2,1H3,(H2,22,24)(H,25,27)/t15-/m0/s1 |
| InChIKey | SIGSXUVBHVCOPM-HNNXBMFYSA-N |
| XLogP | 3.34 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|