C15H13ClFN3O3S — CID 90654078
N-[[3-(4-amino-3-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-5-chlorothiophene-2-carboxamide (PubChem CID 90654078) has the molecular formula C15H13ClFN3O3S and a molecular weight of 369.81 g/mol. Its IUPAC name is N-[[3-(4-amino-3-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[[3-(4-amino-3-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 90654078 |
| Molecular Formula | C15H13ClFN3O3S |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | N-[[3-(4-amino-3-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-5-chlorothiophene-2-carboxamide |
| SMILES | Nc1ccc(N2CC(CNC(=O)c3ccc(Cl)s3)OC2=O)cc1F |
| InChI | InChI=1S/C15H13ClFN3O3S/c16-13-4-3-12(24-13)14(21)19-6-9-7-20(15(22)23-9)8-1-2-11(18)10(17)5-8/h1-5,9H,6-7,18H2,(H,19,21) |
| InChIKey | IUNKWRMKIQXHKM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|