C19H19Cl2N3O4S — CID 21070740
5-chloro-N-[[3-(3-chloro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]thiophene-2-carboxamide (PubChem CID 21070740) has the molecular formula C19H19Cl2N3O4S and a molecular weight of 456.35 g/mol. Its IUPAC name is 5-chloro-N-[[3-(3-chloro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[[3-(3-chloro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 21070740 |
| Molecular Formula | C19H19Cl2N3O4S |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 5-chloro-N-[[3-(3-chloro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCC1CN(c2ccc(N3CCOCC3)c(Cl)c2)C(=O)O1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C19H19Cl2N3O4S/c20-14-9-12(1-2-15(14)23-5-7-27-8-6-23)24-11-13(28-19(24)26)10-22-18(25)16-3-4-17(21)29-16/h1-4,9,13H,5-8,10-11H2,(H,22,25) |
| InChIKey | VRACWCMNTPKTQF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|