C26H30ClN3O3S — CID 160650851
1-(5-chlorothiophen-2-yl)-3-[3-[2-cyclopentyloxy-4-(pyrrolidine-1-carboximidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]propan-1-one (PubChem CID 160650851) has the molecular formula C26H30ClN3O3S and a molecular weight of 500.06 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-3-[3-[2-cyclopentyloxy-4-(pyrrolidine-1-carboximidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]propan-1-one.
| Compound Name | 1-(5-chlorothiophen-2-yl)-3-[3-[2-cyclopentyloxy-4-(pyrrolidine-1-carboximidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]propan-1-one |
|---|---|
| PubChem CID | 160650851 |
| Molecular Formula | C26H30ClN3O3S |
| Molecular Weight | 500.06 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-3-[3-[2-cyclopentyloxy-4-(pyrrolidine-1-carboximidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]propan-1-one |
| SMILES | [H]/N=C(/c1ccc(C2=NOC(CCC(=O)c3ccc(Cl)s3)C2)c(OC2CCCC2)c1)N1CCCC1 |
| InChI | InChI=1S/C26H30ClN3O3S/c27-25-12-11-24(34-25)22(31)10-8-19-16-21(29-33-19)20-9-7-17(26(28)30-13-3-4-14-30)15-23(20)32-18-5-1-2-6-18/h7,9,11-12,15,18-19,28H,1-6,8,10,13-14,16H2/b28-26- |
| InChIKey | RKJXUJICXFJWEK-SGEDCAFJSA-N |
| XLogP | 6.30 |
| TPSA | 74.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.06 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|