C23H22ClN3O3S — CID 159005397
4-[5-[3-(5-chlorothiophen-2-yl)-3-oxopropyl]-4,5-dihydro-1,2-oxazol-3-yl]-N-(furan-2-ylmethyl)-N-methylbenzenecarboximidamide (PubChem CID 159005397) has the molecular formula C23H22ClN3O3S and a molecular weight of 455.97 g/mol. Its IUPAC name is 4-[5-[3-(5-chlorothiophen-2-yl)-3-oxopropyl]-4,5-dihydro-1,2-oxazol-3-yl]-N-(furan-2-ylmethyl)-N-methylbenzenecarboximidamide.
| Compound Name | 4-[5-[3-(5-chlorothiophen-2-yl)-3-oxopropyl]-4,5-dihydro-1,2-oxazol-3-yl]-N-(furan-2-ylmethyl)-N-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 159005397 |
| Molecular Formula | C23H22ClN3O3S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 4-[5-[3-(5-chlorothiophen-2-yl)-3-oxopropyl]-4,5-dihydro-1,2-oxazol-3-yl]-N-(furan-2-ylmethyl)-N-methylbenzenecarboximidamide |
| SMILES | [H]/N=C(/c1ccc(C2=NOC(CCC(=O)c3ccc(Cl)s3)C2)cc1)N(C)Cc1ccco1 |
| InChI | InChI=1S/C23H22ClN3O3S/c1-27(14-18-3-2-12-29-18)23(25)16-6-4-15(5-7-16)19-13-17(30-26-19)8-9-20(28)21-10-11-22(24)31-21/h2-7,10-12,17,25H,8-9,13-14H2,1H3/b25-23- |
| InChIKey | JRVXLFABKOJHDD-BZZOAKBMSA-N |
| XLogP | 5.61 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|