C22H25ClN4O2S — CID 159592867
4-[5-[3-(5-chlorothiophen-2-yl)-3-oxopropyl]-1,2-oxazol-3-yl]-N-[2-(dimethylamino)ethyl]-N-methylbenzenecarboximidamide (PubChem CID 159592867) has the molecular formula C22H25ClN4O2S and a molecular weight of 444.99 g/mol. Its IUPAC name is 4-[5-[3-(5-chlorothiophen-2-yl)-3-oxopropyl]-1,2-oxazol-3-yl]-N-[2-(dimethylamino)ethyl]-N-methylbenzenecarboximidamide.
| Compound Name | 4-[5-[3-(5-chlorothiophen-2-yl)-3-oxopropyl]-1,2-oxazol-3-yl]-N-[2-(dimethylamino)ethyl]-N-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 159592867 |
| Molecular Formula | C22H25ClN4O2S |
| Molecular Weight | 444.99 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 4-[5-[3-(5-chlorothiophen-2-yl)-3-oxopropyl]-1,2-oxazol-3-yl]-N-[2-(dimethylamino)ethyl]-N-methylbenzenecarboximidamide |
| SMILES | [H]/N=C(/c1ccc(-c2cc(CCC(=O)c3ccc(Cl)s3)on2)cc1)N(C)CCN(C)C |
| InChI | InChI=1S/C22H25ClN4O2S/c1-26(2)12-13-27(3)22(24)16-6-4-15(5-7-16)18-14-17(29-25-18)8-9-19(28)20-10-11-21(23)30-20/h4-7,10-11,14,24H,8-9,12-13H2,1-3H3/b24-22- |
| InChIKey | MKLQPXDPFJVAQZ-GYHWCHFESA-N |
| XLogP | 4.69 |
| TPSA | 73.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.99 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|