C20H22ClN5O3S — CID 70331205
5-chloro-N-[[3-[4-(N,N-dimethylcarbamimidoyl)-2-(2-hydroxyethylamino)phenyl]-1,2-oxazol-5-yl]methyl]thiophene-2-carboxamide (PubChem CID 70331205) has the molecular formula C20H22ClN5O3S and a molecular weight of 447.95 g/mol. Its IUPAC name is 5-chloro-N-[[3-[4-(N,N-dimethylcarbamimidoyl)-2-(2-hydroxyethylamino)phenyl]-1,2-oxazol-5-yl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[[3-[4-(N,N-dimethylcarbamimidoyl)-2-(2-hydroxyethylamino)phenyl]-1,2-oxazol-5-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 70331205 |
| Molecular Formula | C20H22ClN5O3S |
| Molecular Weight | 447.95 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 5-chloro-N-[[3-[4-(N,N-dimethylcarbamimidoyl)-2-(2-hydroxyethylamino)phenyl]-1,2-oxazol-5-yl]methyl]thiophene-2-carboxamide |
| SMILES | [H]/N=C(/c1ccc(-c2cc(CNC(=O)c3ccc(Cl)s3)on2)c(NCCO)c1)N(C)C |
| InChI | InChI=1S/C20H22ClN5O3S/c1-26(2)19(22)12-3-4-14(15(9-12)23-7-8-27)16-10-13(29-25-16)11-24-20(28)17-5-6-18(21)30-17/h3-6,9-10,22-23,27H,7-8,11H2,1-2H3,(H,24,28)/b22-19- |
| InChIKey | HQLBSURVILIOFO-QOCHGBHMSA-N |
| XLogP | 3.28 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.95 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|