C24H29ClN4O3S — CID 91259746
5-chloro-N-[[3-[2-cyclohexyloxy-4-(N,N-dimethylcarbamimidoyl)phenyl]-2,5-dihydro-1,2-oxazol-5-yl]methyl]thiophene-2-carboxamide (PubChem CID 91259746) has the molecular formula C24H29ClN4O3S and a molecular weight of 489.04 g/mol. Its IUPAC name is 5-chloro-N-[[3-[2-cyclohexyloxy-4-(N,N-dimethylcarbamimidoyl)phenyl]-2,5-dihydro-1,2-oxazol-5-yl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[[3-[2-cyclohexyloxy-4-(N,N-dimethylcarbamimidoyl)phenyl]-2,5-dihydro-1,2-oxazol-5-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 91259746 |
| Molecular Formula | C24H29ClN4O3S |
| Molecular Weight | 489.04 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 5-chloro-N-[[3-[2-cyclohexyloxy-4-(N,N-dimethylcarbamimidoyl)phenyl]-2,5-dihydro-1,2-oxazol-5-yl]methyl]thiophene-2-carboxamide |
| SMILES | [H]/N=C(/c1ccc(C2=CC(CNC(=O)c3ccc(Cl)s3)ON2)c(OC2CCCCC2)c1)N(C)C |
| InChI | InChI=1S/C24H29ClN4O3S/c1-29(2)23(26)15-8-9-18(20(12-15)31-16-6-4-3-5-7-16)19-13-17(32-28-19)14-27-24(30)21-10-11-22(25)33-21/h8-13,16-17,26,28H,3-7,14H2,1-2H3,(H,27,30)/b26-23- |
| InChIKey | NEAVNOSWWQHTQR-RWEWTDSWSA-N |
| XLogP | 4.67 |
| TPSA | 86.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.04 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|