C21H18ClN3O2S — CID 91555589
N-[[3-[4-(2-aminophenyl)phenyl]-2,5-dihydro-1,2-oxazol-5-yl]methyl]-5-chlorothiophene-2-carboxamide (PubChem CID 91555589) has the molecular formula C21H18ClN3O2S and a molecular weight of 411.91 g/mol. Its IUPAC name is N-[[3-[4-(2-aminophenyl)phenyl]-2,5-dihydro-1,2-oxazol-5-yl]methyl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[[3-[4-(2-aminophenyl)phenyl]-2,5-dihydro-1,2-oxazol-5-yl]methyl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 91555589 |
| Molecular Formula | C21H18ClN3O2S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | N-[[3-[4-(2-aminophenyl)phenyl]-2,5-dihydro-1,2-oxazol-5-yl]methyl]-5-chlorothiophene-2-carboxamide |
| SMILES | Nc1ccccc1-c1ccc(C2=CC(CNC(=O)c3ccc(Cl)s3)ON2)cc1 |
| InChI | InChI=1S/C21H18ClN3O2S/c22-20-10-9-19(28-20)21(26)24-12-15-11-18(25-27-15)14-7-5-13(6-8-14)16-3-1-2-4-17(16)23/h1-11,15,25H,12,23H2,(H,24,26) |
| InChIKey | JFGQIDBWBQUCIC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|