C13H12Cl2N2O2S2 — CID 3490004
5-chloro-N-[2-[(5-chlorothiophene-2-carbonyl)amino]propyl]thiophene-2-carboxamide (PubChem CID 3490004) has the molecular formula C13H12Cl2N2O2S2 and a molecular weight of 363.29 g/mol. Its IUPAC name is 5-chloro-N-[2-[(5-chlorothiophene-2-carbonyl)amino]propyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[2-[(5-chlorothiophene-2-carbonyl)amino]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3490004 |
| Molecular Formula | C13H12Cl2N2O2S2 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 5-chloro-N-[2-[(5-chlorothiophene-2-carbonyl)amino]propyl]thiophene-2-carboxamide |
| SMILES | CC(CNC(=O)c1ccc(Cl)s1)NC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H12Cl2N2O2S2/c1-7(17-13(19)9-3-5-11(15)21-9)6-16-12(18)8-2-4-10(14)20-8/h2-5,7H,6H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | JUMWHYLFLOXKGP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |