C8H9Cl2NO2S — CID 78109019
5-chloro-N-(3-chloro-2-hydroxypropyl)thiophene-2-carboxamide (PubChem CID 78109019) has the molecular formula C8H9Cl2NO2S and a molecular weight of 254.14 g/mol. Its IUPAC name is 5-chloro-N-(3-chloro-2-hydroxypropyl)thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(3-chloro-2-hydroxypropyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78109019 |
| Molecular Formula | C8H9Cl2NO2S |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | 5-chloro-N-(3-chloro-2-hydroxypropyl)thiophene-2-carboxamide |
| SMILES | O=C(NCC(O)CCl)c1ccc(Cl)s1 |
| InChI | InChI=1S/C8H9Cl2NO2S/c9-3-5(12)4-11-8(13)6-1-2-7(10)14-6/h1-2,5,12H,3-4H2,(H,11,13) |
| InChIKey | XSGMBZPBLJKZLG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|