C11H10ClNO3S — CID 95986574
5-chloro-N-[(2S)-2-(furan-3-yl)-2-hydroxyethyl]thiophene-2-carboxamide (PubChem CID 95986574) has the molecular formula C11H10ClNO3S and a molecular weight of 271.73 g/mol. Its IUPAC name is 5-chloro-N-[(2S)-2-(furan-3-yl)-2-hydroxyethyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[(2S)-2-(furan-3-yl)-2-hydroxyethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 95986574 |
| Molecular Formula | C11H10ClNO3S |
| Molecular Weight | 271.73 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | 5-chloro-N-[(2S)-2-(furan-3-yl)-2-hydroxyethyl]thiophene-2-carboxamide |
| SMILES | O=C(NC[C@@H](O)c1ccoc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H10ClNO3S/c12-10-2-1-9(17-10)11(15)13-5-8(14)7-3-4-16-6-7/h1-4,6,8,14H,5H2,(H,13,15)/t8-/m1/s1 |
| InChIKey | PWERFTBTGJKUDB-MRVPVSSYSA-N |
| XLogP | 2.46 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.73 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |