C17H15NO3 — CID 95986596
N-[(2S)-2-(furan-3-yl)-2-hydroxyethyl]naphthalene-1-carboxamide (PubChem CID 95986596) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is N-[(2S)-2-(furan-3-yl)-2-hydroxyethyl]naphthalene-1-carboxamide.
| Compound Name | N-[(2S)-2-(furan-3-yl)-2-hydroxyethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 95986596 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | N-[(2S)-2-(furan-3-yl)-2-hydroxyethyl]naphthalene-1-carboxamide |
| SMILES | O=C(NC[C@@H](O)c1ccoc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H15NO3/c19-16(13-8-9-21-11-13)10-18-17(20)15-7-3-5-12-4-1-2-6-14(12)15/h1-9,11,16,19H,10H2,(H,18,20)/t16-/m1/s1 |
| InChIKey | FHUQLHLXUNVJHS-MRXNPFEDSA-N |
| XLogP | 2.90 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |