C22H34ClN3O3SSi — CID 68659043
N-[(2S)-3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]anilino]-2-hydroxypropyl]-5-chlorothiophene-2-carboxamide (PubChem CID 68659043) has the molecular formula C22H34ClN3O3SSi and a molecular weight of 484.14 g/mol. Its IUPAC name is N-[(2S)-3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]anilino]-2-hydroxypropyl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[(2S)-3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]anilino]-2-hydroxypropyl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 68659043 |
| Molecular Formula | C22H34ClN3O3SSi |
| Molecular Weight | 484.14 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | N-[(2S)-3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]anilino]-2-hydroxypropyl]-5-chlorothiophene-2-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCNc1ccc(NC[C@H](O)CNC(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C22H34ClN3O3SSi/c1-22(2,3)31(4,5)29-13-12-24-16-6-8-17(9-7-16)25-14-18(27)15-26-21(28)19-10-11-20(23)30-19/h6-11,18,24-25,27H,12-15H2,1-5H3,(H,26,28)/t18-/m0/s1 |
| InChIKey | XABKGUBLHCIKMI-SFHVURJKSA-N |
| XLogP | 5.04 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.14 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|