C23H36ClN3O3SSi — CID 72539287
N-[3-[4-[3-[tert-butyl(dimethyl)silyl]oxypropylamino]anilino]-2-hydroxypropyl]-5-chlorothiophene-2-carboxamide (PubChem CID 72539287) has the molecular formula C23H36ClN3O3SSi and a molecular weight of 498.17 g/mol. Its IUPAC name is N-[3-[4-[3-[tert-butyl(dimethyl)silyl]oxypropylamino]anilino]-2-hydroxypropyl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[3-[4-[3-[tert-butyl(dimethyl)silyl]oxypropylamino]anilino]-2-hydroxypropyl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 72539287 |
| Molecular Formula | C23H36ClN3O3SSi |
| Molecular Weight | 498.17 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | N-[3-[4-[3-[tert-butyl(dimethyl)silyl]oxypropylamino]anilino]-2-hydroxypropyl]-5-chlorothiophene-2-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCCNc1ccc(NCC(O)CNC(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C23H36ClN3O3SSi/c1-23(2,3)32(4,5)30-14-6-13-25-17-7-9-18(10-8-17)26-15-19(28)16-27-22(29)20-11-12-21(24)31-20/h7-12,19,25-26,28H,6,13-16H2,1-5H3,(H,27,29) |
| InChIKey | OOHPYUNHUZILAB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.17 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|