C26H32ClN3O3SSi — CID 59140524
N-[2-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]phenyl]carbamoyl]phenyl]-5-chlorothiophene-2-carboxamide (PubChem CID 59140524) has the molecular formula C26H32ClN3O3SSi and a molecular weight of 530.17 g/mol. Its IUPAC name is N-[2-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]phenyl]carbamoyl]phenyl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[2-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]phenyl]carbamoyl]phenyl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 59140524 |
| Molecular Formula | C26H32ClN3O3SSi |
| Molecular Weight | 530.17 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | N-[2-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]phenyl]carbamoyl]phenyl]-5-chlorothiophene-2-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCNc1ccc(NC(=O)c2ccccc2NC(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C26H32ClN3O3SSi/c1-26(2,3)35(4,5)33-17-16-28-18-10-12-19(13-11-18)29-24(31)20-8-6-7-9-21(20)30-25(32)22-14-15-23(27)34-22/h6-15,28H,16-17H2,1-5H3,(H,29,31)(H,30,32) |
| InChIKey | DAVHVLVKVGSRQN-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.17 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|