C27H30Cl2N4O3SSi — CID 59140512
N-[2-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-isocyanoamino]phenyl]carbamoyl]-5-chlorophenyl]-5-chlorothiophene-2-carboxamide (PubChem CID 59140512) has the molecular formula C27H30Cl2N4O3SSi and a molecular weight of 589.62 g/mol. Its IUPAC name is N-[2-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-isocyanoamino]phenyl]carbamoyl]-5-chlorophenyl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[2-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-isocyanoamino]phenyl]carbamoyl]-5-chlorophenyl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 59140512 |
| Molecular Formula | C27H30Cl2N4O3SSi |
| Molecular Weight | 589.62 g/mol |
| Exact Mass | 588.12 |
| IUPAC Name | N-[2-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-isocyanoamino]phenyl]carbamoyl]-5-chlorophenyl]-5-chlorothiophene-2-carboxamide |
| SMILES | [C-]#[N+]N(CCO[Si](C)(C)C(C)(C)C)c1ccc(NC(=O)c2ccc(Cl)cc2NC(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C27H30Cl2N4O3SSi/c1-27(2,3)38(5,6)36-16-15-33(30-4)20-10-8-19(9-11-20)31-25(34)21-12-7-18(28)17-22(21)32-26(35)23-13-14-24(29)37-23/h7-14,17H,15-16H2,1-3,5-6H3,(H,31,34)(H,32,35) |
| InChIKey | VAQVTSXWWRIRON-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 75.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.62 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|