C27H31ClN6O3Si — CID 59140540
N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-isocyanoamino]phenyl]-3-[(4-chlorobenzoyl)amino]pyrazine-2-carboxamide (PubChem CID 59140540) has the molecular formula C27H31ClN6O3Si and a molecular weight of 551.12 g/mol. Its IUPAC name is N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-isocyanoamino]phenyl]-3-[(4-chlorobenzoyl)amino]pyrazine-2-carboxamide.
| Compound Name | N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-isocyanoamino]phenyl]-3-[(4-chlorobenzoyl)amino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59140540 |
| Molecular Formula | C27H31ClN6O3Si |
| Molecular Weight | 551.12 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-isocyanoamino]phenyl]-3-[(4-chlorobenzoyl)amino]pyrazine-2-carboxamide |
| SMILES | [C-]#[N+]N(CCO[Si](C)(C)C(C)(C)C)c1ccc(NC(=O)c2nccnc2NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H31ClN6O3Si/c1-27(2,3)38(5,6)37-18-17-34(29-4)22-13-11-21(12-14-22)32-26(36)23-24(31-16-15-30-23)33-25(35)19-7-9-20(28)10-8-19/h7-16H,17-18H2,1-3,5-6H3,(H,32,36)(H,31,33,35) |
| InChIKey | XINZLXCGSPZNHL-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.12 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|