C29H43ClO7Si — CID 164811325
[4-[2-[2-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-(4-chlorophenyl)methanone (PubChem CID 164811325) has the molecular formula C29H43ClO7Si and a molecular weight of 567.20 g/mol. Its IUPAC name is [4-[2-[2-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-(4-chlorophenyl)methanone.
| Compound Name | [4-[2-[2-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 164811325 |
| Molecular Formula | C29H43ClO7Si |
| Molecular Weight | 567.20 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | [4-[2-[2-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-(4-chlorophenyl)methanone |
| SMILES | CC(C)(C)[Si](C)(C)OCCOCCOCCOCCOCCOc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C29H43ClO7Si/c1-29(2,3)38(4,5)37-23-21-35-19-17-33-15-14-32-16-18-34-20-22-36-27-12-8-25(9-13-27)28(31)24-6-10-26(30)11-7-24/h6-13H,14-23H2,1-5H3 |
| InChIKey | JCKRBKWUYPXESO-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.20 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|