C15H23F3O2Si — CID 70670992
tert-butyl-dimethyl-[2-[4-(trifluoromethyl)phenoxy]ethoxy]silane (PubChem CID 70670992) has the molecular formula C15H23F3O2Si and a molecular weight of 320.43 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-[4-(trifluoromethyl)phenoxy]ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-[4-(trifluoromethyl)phenoxy]ethoxy]silane |
|---|---|
| PubChem CID | 70670992 |
| Molecular Formula | C15H23F3O2Si |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | tert-butyl-dimethyl-[2-[4-(trifluoromethyl)phenoxy]ethoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCOc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H23F3O2Si/c1-14(2,3)21(4,5)20-11-10-19-13-8-6-12(7-9-13)15(16,17)18/h6-9H,10-11H2,1-5H3 |
| InChIKey | GDQKVXJSHUBAQN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|