C26H37NO4Si — CID 16659289
4-[2-[4-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]phenyl]ethynyl]aniline (PubChem CID 16659289) has the molecular formula C26H37NO4Si and a molecular weight of 455.67 g/mol. Its IUPAC name is 4-[2-[4-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]phenyl]ethynyl]aniline.
| Compound Name | 4-[2-[4-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]phenyl]ethynyl]aniline |
|---|---|
| PubChem CID | 16659289 |
| Molecular Formula | C26H37NO4Si |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 4-[2-[4-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]phenyl]ethynyl]aniline |
| SMILES | CC(C)(C)[Si](C)(C)OCCOCCOCCOc1ccc(C#Cc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C26H37NO4Si/c1-26(2,3)32(4,5)31-21-19-29-17-16-28-18-20-30-25-14-10-23(11-15-25)7-6-22-8-12-24(27)13-9-22/h8-15H,16-21,27H2,1-5H3 |
| InChIKey | WOROHODIAJWRDO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|